1-nitro-4-[6-(4-nitrophenoxy)hexa-2,4-diynoxy]benzene structure
|
Common Name | 1-nitro-4-[6-(4-nitrophenoxy)hexa-2,4-diynoxy]benzene | ||
|---|---|---|---|---|
| CAS Number | 22167-51-7 | Molecular Weight | 352.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-4-[6-(4-nitrophenoxy)hexa-2,4-diynoxy]benzene |
|---|
| Molecular Formula | C18H12N2O6 |
|---|---|
| Molecular Weight | 352.29800 |
| Exact Mass | 352.07000 |
| PSA | 110.10000 |
| LogP | 4.01400 |
| InChIKey | OPZMDFYOYNXIPX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCC#CC#CCOc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-nitro-4-[6-(4... CAS#:22167-51-7 |
| Literature: Ashley et al. Journal of the Chemical Society, 1958 , p. 3298,3308 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |