4-[6-(4-aminophenoxy)hexoxy]aniline structure
|
Common Name | 4-[6-(4-aminophenoxy)hexoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 47244-09-7 | Molecular Weight | 300.39500 | |
| Density | 1.151g/cm3 | Boiling Point | 466.7ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.8ºC | |
| Name | 4-[6-(4-aminophenoxy)hexoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 466.7ºC at 760 mmHg |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.39500 |
| Flash Point | 249.8ºC |
| Exact Mass | 300.18400 |
| PSA | 70.50000 |
| LogP | 5.03160 |
| Index of Refraction | 1.599 |
| InChIKey | GRFCDFDVGOXFPY-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OCCCCCCOc2ccc(N)cc2)cc1 |
| HS Code | 2922299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-hexanediyldioxy-di-aniline |
| 4,4'-Hexandiyldioxy-di-anilin |