N-[4-[bis(2-iodoethyl)amino]phenyl]acetamide structure
|
Common Name | N-[4-[bis(2-iodoethyl)amino]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 2045-11-6 | Molecular Weight | 458.07700 | |
| Density | 1.981g/cm3 | Boiling Point | 520.2ºC at 760 mmHg | |
| Molecular Formula | C12H16I2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.4ºC | |
| Name | N-[4-[bis(2-iodoethyl)amino]phenyl]acetamide |
|---|
| Density | 1.981g/cm3 |
|---|---|
| Boiling Point | 520.2ºC at 760 mmHg |
| Molecular Formula | C12H16I2N2O |
| Molecular Weight | 458.07700 |
| Flash Point | 268.4ºC |
| Exact Mass | 457.93500 |
| PSA | 35.83000 |
| LogP | 3.97090 |
| Vapour Pressure | 6.36E-11mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | HNIFPOLBBBMRDY-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(N(CCI)CCI)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[4-[bis(2-iod... CAS#:2045-11-6 |
| Literature: Bardos,T.J. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 167 - 174 |
|
~%
N-[4-[bis(2-iod... CAS#:2045-11-6 |
| Literature: Bardos,T.J. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 167 - 174 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |