4'-[Bis(2-bromoethyl)amino]acetanilide structure
|
Common Name | 4'-[Bis(2-bromoethyl)amino]acetanilide | ||
|---|---|---|---|---|
| CAS Number | 2045-17-2 | Molecular Weight | 364.07600 | |
| Density | 1.655g/cm3 | Boiling Point | 493.4ºC at 760 mmHg | |
| Molecular Formula | C12H16Br2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.2ºC | |
| Name | N-[4-[bis(2-bromoethyl)amino]phenyl]acetamide |
|---|
| Density | 1.655g/cm3 |
|---|---|
| Boiling Point | 493.4ºC at 760 mmHg |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.07600 |
| Flash Point | 252.2ºC |
| Exact Mass | 361.96300 |
| PSA | 35.83000 |
| LogP | 3.89070 |
| Vapour Pressure | 7.07E-10mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | HDIDAFMIJYIOOS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(N(CCBr)CCBr)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
4'-[Bis(2-bromo... CAS#:2045-17-2 |
| Literature: Bardos,T.J. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 167 - 174 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |