2,2,2-Trifluoro-N-{2-[4-(trifluoromethyl)phenyl]ethyl}acetamide
Modify Date: 2025-08-27 10:59:36
![2,2,2-Trifluoro-N-{2-[4-(trifluoromethyl)phenyl]ethyl}acetamide Structure](https://image.chemsrc.com/caspic/345/199678-28-9.png)
2,2,2-Trifluoro-N-{2-[4-(trifluoromethyl)phenyl]ethyl}acetamide structure
|
Common Name | 2,2,2-Trifluoro-N-{2-[4-(trifluoromethyl)phenyl]ethyl}acetamide | ||
|---|---|---|---|---|
| CAS Number | 199678-28-9 | Molecular Weight | 285.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,2-Trifluoro-N-{2-[4-(trifluoromethyl)phenyl]ethyl}acetamide |
|---|
| Molecular Formula | C11H9F6NO |
|---|---|
| Molecular Weight | 285.18600 |
| Exact Mass | 285.05900 |
| PSA | 32.59000 |
| LogP | 3.76670 |
| InChIKey | GVNYFAWTACKXNV-UHFFFAOYSA-N |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cc1)C(F)(F)F |
| Storage condition | 2-8℃ |
|
~88%
2,2,2-Trifluoro... CAS#:199678-28-9 |
| Literature: MERCK and CO., INC.; MERCK SHARP and DOHME LIMITED Patent: WO2004/94371 A2, 2004 ; Location in patent: Page 57-58 ; WO 2004/094371 A2 |
|
~10%
2,2,2-Trifluoro... CAS#:199678-28-9 |
| Literature: MERCK and CO., INC.; MERCK SHARP and DOHME LIMITED Patent: WO2003/93231 A2, 2003 ; Location in patent: Page/Page column 48-49 ; WO 03/093231 A2 |
|
~88%
2,2,2-Trifluoro... CAS#:199678-28-9 |
| Literature: Yang, Lihu; Mills, Sander G.; Zhou, Changyou; Goble, Stephen D.; Pasternak, Alexander Patent: US2007/179158 A1, 2007 ; Location in patent: Page/Page column 14 ; US 20070179158 A1 |
|
~98%
2,2,2-Trifluoro... CAS#:199678-28-9 |
| Literature: MERCK and CO., INC. Patent: WO2005/80371 A1, 2005 ; Location in patent: Page/Page column 49 ; WO 2005/080371 A1 |
