1-(tert-butylamino)-3-(2-phenylphenoxy)propan-2-ol structure
|
Common Name | 1-(tert-butylamino)-3-(2-phenylphenoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 18965-97-4 | Molecular Weight | 299.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(tert-butylamino)-3-(2-phenylphenoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H25NO2 |
|---|---|
| Molecular Weight | 299.40700 |
| Exact Mass | 299.18900 |
| PSA | 41.49000 |
| LogP | 3.87230 |
| Vapour Pressure | 3.44E-09mmHg at 25°C |
| InChIKey | DBHPVKNFKBKJCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(O)COc1ccccc1-c1ccccc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Berlafenona |
| Berlafenone |
| UNII-4MYE3XA3GV |
| Bipranol |
| Berlafenonum |
| Berlafenonum [INN-Latin] |