1-(tert-butylamino)-3-(2-propan-2-ylanilino)propan-2-ol structure
|
Common Name | 1-(tert-butylamino)-3-(2-propan-2-ylanilino)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 98599-15-6 | Molecular Weight | 264.40600 | |
| Density | 0.998g/cm3 | Boiling Point | 409.6ºC at 760 mmHg | |
| Molecular Formula | C16H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.4ºC | |
| Name | 1-(tert-butylamino)-3-(2-propan-2-ylanilino)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.998g/cm3 |
|---|---|
| Boiling Point | 409.6ºC at 760 mmHg |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.40600 |
| Flash Point | 98.4ºC |
| Exact Mass | 264.22000 |
| PSA | 44.29000 |
| LogP | 3.43480 |
| Index of Refraction | 1.538 |
| InChIKey | YRZFJOXDDNCCDX-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccccc1NCC(O)CNC(C)(C)C |
|
~%
1-(tert-butylam... CAS#:98599-15-6 |
| Literature: Laguerre; Boyer; Carpy; Leger; Panconi; Vaugien; Cognic European Journal of Medicinal Chemistry, 1993 , vol. 28, # 1 p. 77 - 80 |
|
~%
1-(tert-butylam... CAS#:98599-15-6 |
| Literature: Laguerre; Boyer; Carpy; Leger; Panconi; Vaugien; Cognic European Journal of Medicinal Chemistry, 1993 , vol. 28, # 1 p. 77 - 80 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-((1,1-Dimethylethyl)amino)-3-((2-(1-methylethyl)phenyl)amino)-2-propanol |
| 2-Propanol,1-((1,1-dimethylethyl)amino)-3-((2-(1-methylethyl)phenyl)amino) |