7'-O-DMT-morpholino thymine structure
|
Common Name | 7'-O-DMT-morpholino thymine | ||
|---|---|---|---|---|
| CAS Number | 143485-05-6 | Molecular Weight | 543.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H33N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 7'-O-DMT-morpholino thymine7'-O-DMT-morpholino thymine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 7'-O-DMT-morpholino thymine |
|---|
| Description | 7'-O-DMT-morpholino thymine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C31H33N3O6 |
|---|---|
| Molecular Weight | 543.61 |
| InChIKey | RPBDWQROLYXOSD-WUFINQPMSA-N |
| SMILES | COc1ccc(C(OCC2CNCC(n3cc(C)c(=O)[nH]c3=O)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |