ethyl 4-(4-formyl-2-methoxyphenoxy)butanoate structure
|
Common Name | ethyl 4-(4-formyl-2-methoxyphenoxy)butanoate | ||
|---|---|---|---|---|
| CAS Number | 141333-27-9 | Molecular Weight | 266.29000 | |
| Density | 1.132g/cm3 | Boiling Point | 408.9ºC at 760 mmHg | |
| Molecular Formula | C14H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.6ºC | |
| Name | ethyl 4-(4-formyl-2-methoxyphenoxy)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 408.9ºC at 760 mmHg |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29000 |
| Flash Point | 219.6ºC |
| Exact Mass | 266.11500 |
| PSA | 61.83000 |
| LogP | 2.22980 |
| Vapour Pressure | 6.76E-07mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | YJRYCFVLCSZEAG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCOc1ccc(C=O)cc1OC |
| HS Code | 2918990090 |
|---|
|
~99%
ethyl 4-(4-form... CAS#:141333-27-9 |
| Literature: Shi, Qian; Wada, Koji; Ohkoshi, Emika; Lin, Li; Huang, Rong; Morris-Natschke, Susan L.; Goto, Masuo; Lee, Kuo-Hsiung Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 13 p. 4020 - 4031 |
|
~%
ethyl 4-(4-form... CAS#:141333-27-9 |
| Literature: SmithKline Beecham Corporation Patent: US5393788 A1, 1995 ; US 5393788 A |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 4-(4-formyl-3-methoxy)-phenyl butyrate |
| Butanoic acid,4-(4-formyl-2-methoxyphenoxy)-,ethyl ester |
| 4-(4-Formyl-2-methoxyphenoxy)butanoic acid,ethyl ester |
| OR0575 |