2-[(2-acetylphenyl)carbamoyl]benzoic acid structure
|
Common Name | 2-[(2-acetylphenyl)carbamoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 114601-91-1 | Molecular Weight | 283.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-acetylphenyl)carbamoyl]benzoic acid |
|---|
| Molecular Formula | C16H13NO4 |
|---|---|
| Molecular Weight | 283.27900 |
| Exact Mass | 283.08400 |
| PSA | 86.96000 |
| LogP | 3.22370 |
| InChIKey | AVEKPYGFPVGVJC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccccc1NC(=O)c1ccccc1C(=O)O |
|
~%
2-[(2-acetylphe... CAS#:114601-91-1 |
| Literature: Bogert; Nabenhauer Journal of the American Chemical Society, 1924 , vol. 46, p. 1705,1933 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |