4-(4-butoxyphenyl)phenol
Modify Date: 2025-08-24 08:27:35
4-(4-butoxyphenyl)phenol structure
|
Common Name | 4-(4-butoxyphenyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 108177-64-6 | Molecular Weight | 242.31300 | |
| Density | N/A | Boiling Point | 383.6ºC at 760 mmHg | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.3ºC | |
| Name | 4-(4-butoxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 383.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.31300 |
| Flash Point | 197.3ºC |
| Exact Mass | 242.13100 |
| PSA | 29.46000 |
| LogP | 4.23810 |
| InChIKey | MWWKMFTXNBHVJT-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(-c2ccc(O)cc2)cc1 |
| HS Code | 2922299090 |
|---|
|
~42%
4-(4-butoxyphen... CAS#:108177-64-6 |
| Literature: Orzeszko, Barbara; Melon-Ksyta, Dorota; Orzeszko, Andrzej Synthetic Communications, 2002 , vol. 32, # 22 p. 3425 - 3429 |
|
~46%
4-(4-butoxyphen... CAS#:108177-64-6 |
| Literature: Pollino, Joel M.; Weck, Marcus Synthesis, 2002 , # 9 p. 1277 - 1285 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-butoxybiphenyl-4-ol |
| 4-butoxy-4'-biphenol |
| 4-hydroxy-4'-butoxydiphenyl |
| 4'-butyloxy-biphenyl-4-ol |
| 4-Butoxy-4'-hydroxybiphenyl |
| [1,1'-Biphenyl]-4-ol,4'-butoxy |