N-(diethylamino-methyl-phenylsilyl)-N-ethylethanamine structure
|
Common Name | N-(diethylamino-methyl-phenylsilyl)-N-ethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 1023-81-0 | Molecular Weight | 264.48200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28N2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(diethylamino-methyl-phenylsilyl)-N-ethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H28N2Si |
|---|---|
| Molecular Weight | 264.48200 |
| Exact Mass | 264.20200 |
| PSA | 6.48000 |
| LogP | 2.64920 |
| InChIKey | PHFMFGRSEHZUAU-UHFFFAOYSA-N |
| SMILES | CCN(CC)[Si](C)(c1ccccc1)N(CC)CC |
| HS Code | 2931900090 |
|---|
|
~56%
N-(diethylamino... CAS#:1023-81-0 |
| Literature: Jung, Eun Ae; Park, Young Tae Bulletin of the Korean Chemical Society, 2012 , vol. 33, # 6 p. 2031 - 2036 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Bis-diaethylamino-methyl-phenyl-silan |
| bis(diethylamino)methylphenylsilane |
| methylphenyl-bis(diethylamino)silane |
| tetra-N-ethyl-Si-methyl-Si-phenyl-silanediamine |
| Silanediamine,N,N,N',N'-tetraethyl-1-methyl-1-phenyl |