4-(tert-butylamino)benzoic acid
Modify Date: 2025-08-25 21:44:03
4-(tert-butylamino)benzoic acid structure
|
Common Name | 4-(tert-butylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 99985-73-6 | Molecular Weight | 193.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(tert-butylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15NO2 |
|---|---|
| Molecular Weight | 193.24200 |
| Exact Mass | 193.11000 |
| PSA | 49.33000 |
| LogP | 2.66820 |
| InChIKey | HSQUIQMFMBAAEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Nc1ccc(C(=O)O)cc1 |
| HS Code | 2922499990 |
|---|
|
~%
4-(tert-butylam... CAS#:99985-73-6 |
| Literature: Shiseido Co., Ltd. Patent: US5912258 A1, 1999 ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-[(tert-butyl)amino]benzoic acid |