N-[3-cyano-4-(3,4-dichlorophenoxy)phenyl]acetamide structure
|
Common Name | N-[3-cyano-4-(3,4-dichlorophenoxy)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 99902-88-2 | Molecular Weight | 321.15800 | |
| Density | 1.42g/cm3 | Boiling Point | 496.7ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.2ºC | |
| Name | N-[3-cyano-4-(3,4-dichlorophenoxy)phenyl]acetamide |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 496.7ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.15800 |
| Flash Point | 254.2ºC |
| Exact Mass | 320.01200 |
| PSA | 65.61000 |
| LogP | 5.26528 |
| Index of Refraction | 1.632 |
| InChIKey | GOYZICUSEIYKFO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Oc2ccc(Cl)c(Cl)c2)c(C#N)c1 |
|
~29%
N-[3-cyano-4-(3... CAS#:99902-88-2 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
|
~%
N-[3-cyano-4-(3... CAS#:99902-88-2 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |