2,4-Dichloro-3-ethyl-6-nitrophenol
2,4-Dichloro-3-ethyl-6-nitrophenol structure
|
Common Name | 2,4-Dichloro-3-ethyl-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 99817-36-4 | Molecular Weight | 236.052 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 291.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H7Cl2NO3 | Melting Point | 49-51°C | |
| MSDS | N/A | Flash Point | 129.8±25.9 °C | |
| Name | 2,4-Dichloro-3-ethyl-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 291.0±35.0 °C at 760 mmHg |
| Melting Point | 49-51°C |
| Molecular Formula | C8H7Cl2NO3 |
| Molecular Weight | 236.052 |
| Flash Point | 129.8±25.9 °C |
| Exact Mass | 234.980301 |
| PSA | 66.05000 |
| LogP | 4.40 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | YTVCECQSAPGJBB-UHFFFAOYSA-N |
| SMILES | CCc1c(Cl)cc([N+](=O)[O-])c(O)c1Cl |
| Hazard Codes | T: Toxic;N: Dangerous for the environment;Xi: Irritant; |
|---|---|
| Risk Phrases | 20/21-36/37/38-65-50/53-43-41-25 |
| Safety Phrases | S26-S36/37/39-S61-S60-S45 |
| RIDADR | UN2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2908999090 |
|
~92%
2,4-Dichloro-3-... CAS#:99817-36-4 |
| Literature: Taoka Chemical Company, Ltd. Patent: US5136109 A1, 1992 ; |
|
~90%
2,4-Dichloro-3-... CAS#:99817-36-4 |
| Literature: Taoka Chemical Company, Ltd. Patent: US5136109 A1, 1992 ; |
|
~96%
2,4-Dichloro-3-... CAS#:99817-36-4 |
| Literature: Bayer Aktiengesellschaft Patent: US4670608 A1, 1987 ; |
|
~86%
2,4-Dichloro-3-... CAS#:99817-36-4 |
| Literature: Taoka Chemical Company, Ltd. Patent: US5136109 A1, 1992 ; |
|
~%
2,4-Dichloro-3-... CAS#:99817-36-4 |
| Literature: US5012015 A1, ; |
|
~77%
2,4-Dichloro-3-... CAS#:99817-36-4 |
| Literature: Taoka Chemical Company, Ltd. Patent: US5136109 A1, 1992 ; |
CAS#:99817-37-5| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,4-Dichloro-3-ethyl-6-nitrophenol |
| 2,4-dichloro-3-ethyl-6-nitro-phenol |
| MFCD00270764 |
| Phenol, 2,4-dichloro-3-ethyl-6-nitro- |
| 2,4'-DIBROMOBENZOPHENONE |
| EINECS 420-740-1 |
| 2-Nitro-4,6-dichloro-5-ethylphenol |
| WNR BQ CG EG D2 |