Leucanthogenin structure
|
Common Name | Leucanthogenin | ||
|---|---|---|---|---|
| CAS Number | 99615-00-6 | Molecular Weight | 346.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LeucanthogeninLeucanthogenin is a natural product that can be isolated from Sideritis leucantha[1]. |
| Name | 5,8,3',4'-tetrahydroxy-6,7-dimethoxyflavone |
|---|---|
| Synonym | More Synonyms |
| Description | Leucanthogenin is a natural product that can be isolated from Sideritis leucantha[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H14O8 |
|---|---|
| Molecular Weight | 346.28800 |
| Exact Mass | 346.06900 |
| PSA | 129.59000 |
| LogP | 2.29960 |
| InChIKey | VZNIMRVJHRTTKA-UHFFFAOYSA-N |
| SMILES | COc1c(OC)c(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc2c1O |
| leucanthoflavone |
| leucanthogenin |
| 2-(3,4-Dihydroxy-phenyl)-5,8-dihydroxy-6,7-dimethoxy-chromen-4-one |