2-((2-Hydroxyethyl)amino)-4,6-dinitrophenol structure
|
Common Name | 2-((2-Hydroxyethyl)amino)-4,6-dinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 99610-72-7 | Molecular Weight | 243.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-((2-Hydroxyethyl)amino)-4,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9N3O6 |
|---|---|
| Molecular Weight | 243.17400 |
| Exact Mass | 243.04900 |
| PSA | 144.13000 |
| LogP | 1.73220 |
| InChIKey | OABRBVCUJIJMOB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(NCCO)c(O)c([N+](=O)[O-])c1 |
| Hazard Codes | F,Xn |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(2-hydroxyethylamino)-4,6-dinitrophenol |