1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane
Modify Date: 2025-09-11 06:45:33
1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane structure
|
Common Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane | ||
|---|---|---|---|---|
| CAS Number | 993-95-3 | Molecular Weight | 250.06200 | |
| Density | 1.497g/cm3 | Boiling Point | 63.5ºC at 760 mmHg | |
| Molecular Formula | C5H3F9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 63.5ºC at 760 mmHg |
| Molecular Formula | C5H3F9O |
| Molecular Weight | 250.06200 |
| Exact Mass | 250.00400 |
| PSA | 9.23000 |
| LogP | 3.05850 |
| Index of Refraction | 1.269 |
| InChIKey | LMRGTZDDPWGCGL-UHFFFAOYSA-N |
| SMILES | FC(C(F)(F)F)C(F)(F)OCC(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2909199090 |
|
~78%
1,1,1,2,3,3-hex... CAS#:993-95-3 |
| Literature: Petrov, Viacheslav A.; Davidson, Fred Journal of Fluorine Chemistry, 1999 , vol. 95, # 1-2 p. 5 - 14 |
|
~92%
Detail
|
| Literature: ASAHI GLASS COMPANY, LIMITED Patent: WO2006/123563 A1, 2006 ; Location in patent: Page/Page column 7-8 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| PC3813 |
| HFE-449mec-f |
| Hexafluor-1-<2,2,2-trifluor-aethoxy>-propan |
| 1,1,2,3,3,3-Hexafluoropropyl 2,2,2-trifluoro Ethyl Ether |