N'-(furan-2-carbothioyl)-2-hydroxybenzohydrazide
Modify Date: 2025-08-21 11:14:29
N'-(furan-2-carbothioyl)-2-hydroxybenzohydrazide structure
|
Common Name | N'-(furan-2-carbothioyl)-2-hydroxybenzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 99268-53-8 | Molecular Weight | 262.28400 | |
| Density | 1.401g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(furan-2-carbothioyl)-2-hydroxybenzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.28400 |
| Exact Mass | 262.04100 |
| PSA | 110.08000 |
| LogP | 2.56100 |
| Index of Refraction | 1.669 |
| InChIKey | DHOKMPFJEJABSE-UHFFFAOYSA-N |
| SMILES | O=C(NNC(=S)c1ccco1)c1ccccc1O |
| HS Code | 2932190090 |
|---|
|
~88%
N'-(furan-2-car... CAS#:99268-53-8 |
| Literature: Agrawal, Seema; Singh, N. K. Spectrochimica Acta, Part A: Molecular and Biomolecular Spectroscopy, 1986 , vol. 42, # 4 p. 507 - 514 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| SFTCH |
| N-Salicyloyl-N'-(2-furylthiocarbonyl)hydrazine |
| Benzoic acid,2-hydroxy-,2-(2-furanylthioxomethyl)hydrazide |
| N-salicyl-N'-2-furanthiocarboxyhydrazine |
| 2-Hydroxybenzoic acid 2-(2-furanylthioxomethyl)hydrazide |