4-Isopropoxybenzenesulfonyl chloride structure
|
Common Name | 4-Isopropoxybenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 98995-40-5 | Molecular Weight | 234.70000 | |
| Density | 1.279 g/cm3 | Boiling Point | 112ºC 0,01mm | |
| Molecular Formula | C9H11ClO3S | Melting Point | 30-35ºC | |
| MSDS | N/A | Flash Point | 112-113°C/0.01m | |
| Name | 4-Isopropoxybenzenesulfonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279 g/cm3 |
|---|---|
| Boiling Point | 112ºC 0,01mm |
| Melting Point | 30-35ºC |
| Molecular Formula | C9H11ClO3S |
| Molecular Weight | 234.70000 |
| Flash Point | 112-113°C/0.01m |
| Exact Mass | 234.01200 |
| PSA | 51.75000 |
| LogP | 3.48210 |
| Index of Refraction | 1.522 |
| InChIKey | IJWCRHKAQNFJLT-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)Cl)cc1 |
| Storage condition | 0-10°C |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 |
| Packaging Group | II |
| Hazard Class | 8.0 |
| HS Code | 2909309090 |
|
~%
4-Isopropoxyben... CAS#:98995-40-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 21 p. 6466 - 6476 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD03093083 |
| 4-propan-2-yloxybenzenesulfonyl chloride |