3-(perfluorobutyl)-2-hydroxypropyl acrylate
Modify Date: 2025-08-25 15:15:11
3-(perfluorobutyl)-2-hydroxypropyl acrylate structure
|
Common Name | 3-(perfluorobutyl)-2-hydroxypropyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 98573-25-2 | Molecular Weight | 348.16200 | |
| Density | 1.442 g/mL at 25 °C(lit.) | Boiling Point | 89-90 °C3 mm Hg(lit.) | |
| Molecular Formula | C10H9F9O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | (4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptyl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.442 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 89-90 °C3 mm Hg(lit.) |
| Molecular Formula | C10H9F9O3 |
| Molecular Weight | 348.16200 |
| Flash Point | >230 °F |
| Exact Mass | 348.04100 |
| PSA | 46.53000 |
| LogP | 2.93480 |
| Index of Refraction | n20/D 1.369(lit.) |
| InChIKey | MMZXPRQMECEMRJ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2916129000 |
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00236105 |
| pc5906fd |