1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid structure
|
Common Name | 1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 98534-84-0 | Molecular Weight | 270.20700 | |
| Density | 1.4g/cm3 | Boiling Point | 377.8ºC at 760 mmHg | |
| Molecular Formula | C12H9F3N2O2 | Melting Point | 151-155ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 182.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 377.8ºC at 760 mmHg |
| Melting Point | 151-155ºC(lit.) |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.20700 |
| Flash Point | 182.3ºC |
| Exact Mass | 270.06200 |
| PSA | 55.12000 |
| LogP | 2.89770 |
| Index of Refraction | 1.552 |
| InChIKey | QMBUSCJEARRTEH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2ncc(C(=O)O)c2C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| 1-p-tolyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid |
| 1-(4-Methylphenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid |
| MFCD03934805 |