Haploperoside E structure
|
Common Name | Haploperoside E | ||
|---|---|---|---|---|
| CAS Number | 97938-29-9 | Molecular Weight | 646.59 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 923.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C28H38O17 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 299.7±27.8 °C | |
Use of Haploperoside EDescription Natural product derived from plant source.} |
| Name | Haploperoside E |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 923.4±65.0 °C at 760 mmHg |
| Molecular Formula | C28H38O17 |
| Molecular Weight | 646.59 |
| Flash Point | 299.7±27.8 °C |
| Exact Mass | 646.210876 |
| LogP | 0.81 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | LLQBCHODNVGKSF-RVXDDWIJSA-N |
| SMILES | COc1cc2ccc(=O)oc2cc1OC1OC(COC2OC(C)C(O)C(O)C2O)C(O)C(O)C1OC1OC(C)C(O)C(O)C1O |
| Water Solubility | DMSO:1mg/mL |
| RIDADR | NONH for all modes of transport |
|---|
| MFCD29037219 |