4-Carboxymethyl-6,7-methylenedioxycoumarin
Modify Date: 2025-08-21 12:13:08
4-Carboxymethyl-6,7-methylenedioxycoumarin structure
|
Common Name | 4-Carboxymethyl-6,7-methylenedioxycoumarin | ||
|---|---|---|---|---|
| CAS Number | 97744-77-9 | Molecular Weight | 248.188 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 508.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H8O6 | Melting Point | 195ºC | |
| MSDS | N/A | Flash Point | 205.6±23.6 °C | |
| Name | 2-(6-oxo-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.4±50.0 °C at 760 mmHg |
| Melting Point | 195ºC |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.188 |
| Flash Point | 205.6±23.6 °C |
| Exact Mass | 248.032089 |
| PSA | 85.97000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | PIHRLFGNZWHKIO-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(=O)oc2cc3c(cc12)OCO3 |
| Safety Phrases | 22-24/25 |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (6-Oxo-6H-[1,3]dioxolo[4,5-g]chromen-8-yl)acetic acid |
| C1196 |
| 6H-1,3-Dioxolo[4,5-g][1]benzopyran-8-acetic acid, 6-oxo- |
| 4-Carboxymethyl-6,7-methylenedioxycoumarin |