3’,5’-Di-O-benzoyl-2’-deoxy-2’-fluoro-5-methyl-β-D-arabino-uridine structure
|
Common Name | 3’,5’-Di-O-benzoyl-2’-deoxy-2’-fluoro-5-methyl-β-D-arabino-uridine | ||
|---|---|---|---|---|
| CAS Number | 97614-47-6 | Molecular Weight | 468.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H21FN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3’,5’-Di-O-benzoyl-2’-deoxy-2’-fluoro-5-methyl-β-D-arabino-uridine3’,5’-Di-O-benzoyl-2’-deoxy-2’-fluoro-5-methyl-β-D-arabino-uridine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 1-(3',5'-di-O-benzoyl-2'-deoxy-2'-fluoro-β-D-arabinofuranosyl)thymine |
|---|
| Description | 3’,5’-Di-O-benzoyl-2’-deoxy-2’-fluoro-5-methyl-β-D-arabino-uridine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H21FN2O7 |
|---|---|
| Molecular Weight | 468.43 |
| Exact Mass | 468.13300 |
| PSA | 116.69000 |
| LogP | 2.16310 |
| InChIKey | CEPDPXNYCRCFRV-RCLSDMTESA-N |
| SMILES | Cc1cn(C2OC(COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2F)c(=O)[nH]c1=O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |