3-Nitro-4-chlorophenyl methyl sulfone structure
|
Common Name | 3-Nitro-4-chlorophenyl methyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 97-07-4 | Molecular Weight | 235.645 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 414.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO4S | Melting Point | 175-1760C | |
| MSDS | N/A | Flash Point | 204.3±28.7 °C | |
| Name | 4-Chloro-3-Nitrophenyl Methyl Sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.2±45.0 °C at 760 mmHg |
| Melting Point | 175-1760C |
| Molecular Formula | C7H6ClNO4S |
| Molecular Weight | 235.645 |
| Flash Point | 204.3±28.7 °C |
| Exact Mass | 234.970612 |
| PSA | 88.34000 |
| LogP | 0.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | JAANTSGNTKWLFA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | HQ4025500 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2904909090 |
|
~%
3-Nitro-4-chlor... CAS#:97-07-4 |
| Literature: DE622494 , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 21, p. 347,349 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Chloro-4-methanesulfonyl-2-nitro-benzene |
| Benzene, 1-chloro-4- (methylsulfonyl)-2-nitro- |
| 1-chloro-4-methylsulfonyl-2-nitrobenzene |
| EINECS 202-557-7 |
| Sulfone, 4-chloro-3-nitrophenyl methyl (8CI) |
| MFCD00039754 |
| 4-Chloro-3-nitrophenyl methyl sulphone |
| 3-Nitro-4-chlorophenyl methyl sulfone |
| Sulfone, 4-chloro-3-nitrophenyl methyl |
| 1-Chloro-4-(methylsulfonyl)-2-nitrobenzene |
| Benzene, 1-chloro-4-(methylsulfonyl)-2-nitro- |
| 4-chloro-3-nitrophenyl methyl sulfone |