5-[1-(4-chlorophenyl)propoxy]-5-oxopentanoic acid
Modify Date: 2025-08-24 09:49:52
![5-[1-(4-chlorophenyl)propoxy]-5-oxopentanoic acid Structure](https://image.chemsrc.com/caspic/177/96875-24-0.png)
5-[1-(4-chlorophenyl)propoxy]-5-oxopentanoic acid structure
|
Common Name | 5-[1-(4-chlorophenyl)propoxy]-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 96875-24-0 | Molecular Weight | 284.73500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[1-(4-chlorophenyl)propoxy]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17ClO4 |
|---|---|
| Molecular Weight | 284.73500 |
| Exact Mass | 284.08200 |
| PSA | 63.60000 |
| LogP | 3.58920 |
| InChIKey | LBIWNRQWQRDGHG-UHFFFAOYSA-N |
| SMILES | CCC(OC(=O)CCCC(=O)O)c1ccc(Cl)cc1 |
|
~%
5-[1-(4-chlorop... CAS#:96875-24-0 |
| Literature: Palazzo,G. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1961 , vol. 4, # 3 p. 447 - 456 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| AF 549 |
| Glutarsaeure-mono-<1-(4-chlor-phenyl)-propylester> |