5-[(4-Chlorophenyl)amino]-5-oxopentanoic acid
Modify Date: 2025-09-13 08:22:36
![5-[(4-Chlorophenyl)amino]-5-oxopentanoic acid Structure](https://image.chemsrc.com/caspic/051/40828-92-0.png)
5-[(4-Chlorophenyl)amino]-5-oxopentanoic acid structure
|
Common Name | 5-[(4-Chlorophenyl)amino]-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 40828-92-0 | Molecular Weight | 241.67100 | |
| Density | 1.353g/cm3 | Boiling Point | 501.4ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.1ºC | |
| Name | 5-[(4-Chlorophenyl)amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 501.4ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67100 |
| Flash Point | 257.1ºC |
| Exact Mass | 241.05100 |
| PSA | 66.40000 |
| LogP | 2.60640 |
| Index of Refraction | 1.597 |
| InChIKey | WWDMQLBWGBGYGS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
5-[(4-Chlorophe... CAS#:40828-92-0 |
| Literature: Evans; Roberts Journal of the Chemical Society, 1957 , p. 2104 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-CHLOROPHENYL)GLUTARAMIC ACID |
| 5-(4-chloroanilino)-5-oxopentanoic acid |