5-[(4-Methylphenyl)amino]-5-oxopentanoic acid structure
|
Common Name | 5-[(4-Methylphenyl)amino]-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 71195-71-6 | Molecular Weight | 221.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-Methylphenyl)amino]-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO3 |
|---|---|
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 66.40000 |
| LogP | 2.26140 |
| InChIKey | YRPDUMZWXRBNJE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CCCC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
|
~90%
5-[(4-Methylphe... CAS#:71195-71-6 |
| Literature: Shemchuk; Chernykh Russian Journal of Organic Chemistry, 1998 , vol. 34, # 2 p. 231 - 233 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Tolyl-glutaramidsaeure |
| N-Thiosulfinyl-2,4,6-tribromanilin |
| Benzenamine,2,4,6-tribromo-N-sulfinothioyl |