ethyl prop-2-enoate,tetrachloromethane structure
|
Common Name | ethyl prop-2-enoate,tetrachloromethane | ||
|---|---|---|---|---|
| CAS Number | 96787-63-2 | Molecular Weight | 253.93900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl prop-2-enoate,tetrachloromethane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H8Cl4O2 |
|---|---|
| Molecular Weight | 253.93900 |
| Exact Mass | 251.92800 |
| PSA | 26.30000 |
| LogP | 3.28840 |
| InChIKey | FGZRKUFWVGPICZ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC.ClC(Cl)(Cl)Cl |
| 2-Propenoic acid,ethyl ester,telomer with tetrachloromethane |
| Methane,tetrachloro-,telomer with ethyl 2-propenoate |
| Acrylic acid,ethyl ester,telomer with carbon tetrachloride |
| Carbon tetrachloride-ethyl acrylate telomer |