ethyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,prop-2-enoic acid
Modify Date: 2025-09-18 13:38:50
ethyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,prop-2-enoic acid structure
|
Common Name | ethyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 25852-42-0 | Molecular Weight | 273.28200 | |
| Density | N/A | Boiling Point | 99.5ºC at 760mmHg | |
| Molecular Formula | C12H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 15.6ºC | |
| Name | ethyl prop-2-enoate,N-(hydroxymethyl)prop-2-enamide,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 99.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28200 |
| Flash Point | 15.6ºC |
| Exact Mass | 273.12100 |
| PSA | 116.42000 |
| LogP | 1.07120 |
| InChIKey | FNKLYKSVJPDERE-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NCO.C=CC(=O)O.C=CC(=O)OCC |
| Ethyl 2-propenoate,2-propenoic acid,N-(hydroxymethyl)-2-propenamide polymer |
| 2-Propenoic acid,polymer with ethyl 2-propenoate and N-(hydroxymethyl)-2-propenamide |