(3-amino-4-chlorophenyl)-(5-amino-2-chlorophenyl)methanone
Modify Date: 2025-09-21 22:00:48
(3-amino-4-chlorophenyl)-(5-amino-2-chlorophenyl)methanone structure
|
Common Name | (3-amino-4-chlorophenyl)-(5-amino-2-chlorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 96662-54-3 | Molecular Weight | 281.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-amino-4-chlorophenyl)-(5-amino-2-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10Cl2N2O |
|---|---|
| Molecular Weight | 281.13700 |
| Exact Mass | 280.01700 |
| PSA | 69.11000 |
| LogP | 4.55120 |
| InChIKey | JCIAPCZXVJMSBB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)c(C(=O)c2ccc(Cl)c(N)c2)c1 |
|
~%
(3-amino-4-chlo... CAS#:96662-54-3 |
| Literature: Faith et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 543,546 |
|
~%
(3-amino-4-chlo... CAS#:96662-54-3 |
| Literature: Faith et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 543,546 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,3'-diamino-2,4'-dichloro-benzophenone |
| 5,3'-Diamino-2,4'-dichlor-benzophenon |
| Methanone,(3-amino-4-chlorophenyl)(5-amino-2-chlorophenyl) |