(2-chloro-5-nitro-phenyl)-(4-chloro-3-nitro-phenyl)methanone
Modify Date: 2025-11-08 18:26:43
(2-chloro-5-nitro-phenyl)-(4-chloro-3-nitro-phenyl)methanone structure
|
Common Name | (2-chloro-5-nitro-phenyl)-(4-chloro-3-nitro-phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 87424-35-9 | Molecular Weight | 341.10300 | |
| Density | 1.585g/cm3 | Boiling Point | 516.7ºC at 760 mmHg | |
| Molecular Formula | C13H6Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.3ºC | |
| Name | (2-chloro-5-nitrophenyl)-(4-chloro-3-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 516.7ºC at 760 mmHg |
| Molecular Formula | C13H6Cl2N2O5 |
| Molecular Weight | 341.10300 |
| Flash Point | 266.3ºC |
| Exact Mass | 339.96500 |
| PSA | 108.71000 |
| LogP | 5.08720 |
| Index of Refraction | 1.654 |
| InChIKey | HGHPNFNEFXMGLR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)c1cc([N+](=O)[O-])ccc1Cl |
|
~%
(2-chloro-5-nit... CAS#:87424-35-9 |
| Literature: Faith et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 543,546 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:96662-54-3| 2,4'-Dichlor-5,3'-dinitro-benzophenon |
| 2,4'-dichloro-5,3'-dinitro-benzophenone |