Biotin-PEG9-amine structure
|
Common Name | Biotin-PEG9-amine | ||
|---|---|---|---|---|
| CAS Number | 960132-48-3 | Molecular Weight | 682.86700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H58N4O11S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Biotin-PEG9-amineBiotin-PEG9-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Biotin-PEG9-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C30H58N4O11S |
|---|---|
| Molecular Weight | 682.86700 |
| Exact Mass | 682.38200 |
| PSA | 211.60000 |
| LogP | 1.44590 |
| InChIKey | UHIKHSATVJGWOI-YCVJPRETSA-N |
| SMILES | NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| MFCD08274600 |