Biotin-PEG7-amine structure
|
Common Name | Biotin-PEG7-amine | ||
|---|---|---|---|---|
| CAS Number | 1334172-76-7 | Molecular Weight | 594.7616 | |
| Density | 1.151±0.06 g/cm3 | Boiling Point | 785.9±60.0 °C | |
| Molecular Formula | C26H50N4O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG7-amineBiotin-PEG7-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Biotin-PEG7-Amine |
|---|---|
| Synonym | More Synonyms |
| Description | Biotin-PEG7-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.151±0.06 g/cm3 |
|---|---|
| Boiling Point | 785.9±60.0 °C |
| Molecular Formula | C26H50N4O9S |
| Molecular Weight | 594.7616 |
| InChIKey | HRGIYGOBSBFLMX-LSQMVHIFSA-N |
| SMILES | NCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Storage condition | -20°C |
| MFCD21363308 |