3-(2,4-difluorophenyl)pentanedioic acid
Modify Date: 2025-08-25 10:00:31
3-(2,4-difluorophenyl)pentanedioic acid structure
|
Common Name | 3-(2,4-difluorophenyl)pentanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 959246-68-5 | Molecular Weight | 244.19200 | |
| Density | 1.434g/cm3 | Boiling Point | 349.1ºC at 760 mmHg | |
| Molecular Formula | C11H10F2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 3-(2,4-difluorophenyl)pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 349.1ºC at 760 mmHg |
| Molecular Formula | C11H10F2O4 |
| Molecular Weight | 244.19200 |
| Flash Point | 165ºC |
| Exact Mass | 244.05500 |
| PSA | 74.60000 |
| LogP | 1.99780 |
| Index of Refraction | 1.533 |
| InChIKey | QGQUIQKNIOALOU-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(CC(=O)O)c1ccc(F)cc1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917399090 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(2,4-Difluoro-phenyl)-pentanedioic acid |