N-Cbz-4-hydroxy-1-piperidine structure
|
Common Name | N-Cbz-4-hydroxy-1-piperidine | ||
|---|---|---|---|---|
| CAS Number | 95798-23-5 | Molecular Weight | 235.279 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 384.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 186.6±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Cbz-4-hydroxypiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.9±42.0 °C at 760 mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.279 |
| Flash Point | 186.6±27.9 °C |
| Exact Mass | 235.120850 |
| PSA | 49.77000 |
| LogP | 1.22 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | JKIUUDJOCYHIGY-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCC(O)CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzyl 4-hydroxy-1-piperidinecarboxylate |
| benzyl 4-hydroxypiperidine-1-carboxylate |
| MFCD01863722 |
| 1-Piperidinecarboxylic acid, 4-hydroxy-, phenylmethyl ester |
| benzyl 4-hydroxytetrahydro-1(2H)-pyridinecarboxylate |
| Benzyl-4-hydroxypiperidin-1-carboxylat |
| N-Cbz-4-hydroxy-1-piperidine |