Fmoc-Glu-AMC structure
|
Common Name | Fmoc-Glu-AMC | ||
|---|---|---|---|---|
| CAS Number | 957311-37-4 | Molecular Weight | 526.53700 | |
| Density | 1.377±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 845.0±65.0 °C (760 mmHg) | |
| Molecular Formula | C30H26N2O7 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Fmoc-Glu-AMCFmoc-Glu-AMC is a glutamic acid derivative[1]. |
| Name | Pentanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-[(4-methyl-2-oxo-2H-1-benzopyran-7-yl)amino]-5-oxo-, (4S) |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Glu-AMC is a glutamic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.377±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 845.0±65.0 °C (760 mmHg) |
| Molecular Formula | C30H26N2O7 |
| Molecular Weight | 526.53700 |
| Exact Mass | 526.17400 |
| PSA | 134.94000 |
| LogP | 5.27590 |
| InChIKey | AMGSEJHFHIETMV-VWLOTQADSA-N |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCC(=O)O)NC(=O)OCC3c4ccccc4-c4ccccc43)ccc12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| n-alpha-(9-fluorenylmethyloxycarbonyl)-l-glutamic acid alpha-(7-amido-4-methylcoumarin) |
| fmoc-l-glu-amc n-alpha-(9-fluorenylmethyloxycarbonyl)-l-glutamic acid alpha-(7-amido-4-methylcoumarin) |
| fmoc-glu-amc |