n,n'-di(n-heptyl)-perylene-tetracarbonic acid, diamide structure
|
Common Name | n,n'-di(n-heptyl)-perylene-tetracarbonic acid, diamide | ||
|---|---|---|---|---|
| CAS Number | 95689-91-1 | Molecular Weight | 586.71900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H38N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | n,n'-di(n-heptyl)-perylene-tetracarbonic acid, diamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C38H38N2O4 |
|---|---|
| Molecular Weight | 586.71900 |
| Exact Mass | 586.28300 |
| PSA | 78.14000 |
| LogP | 7.90380 |
| InChIKey | WXLGICNTPAGZCR-UHFFFAOYSA-N |
| SMILES | CCCCCCCN1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(CCCCCCC)C5=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
Dual carrier traps related hysteresis in organic inverters with polyimide-modified gate-dielectrics
Appl. Phys. Lett. 15th ed., 96 , 153302/1-153302/3, (2010)
|
|
|
Geometry and Electronic Coupling in Perylenediimide Stacks: Mapping Structure-Charge Transport Relationships
J. Am. Chem. Soc. 6th ed., 132 , 1739-1739, (2010)
|
| N,N'-Bis(n-heptyl)-3,4,9,10-perylenedicarboximide |
| 2,9-Diheptylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)tetrone |
| HepPTC |
| N,N'-diheptyl-3,4,9,10-perylenedicarboximide |
| 2,9-Di(n-heptyl)-anthra2,1,9-def.6,5,10-d'e'f'diisoquinoline-1,3,8,10-tetrone |