(2-aminopyrimidin-5-yl)-(2-hydroxy-4-methylphenyl)methanone structure
|
Common Name | (2-aminopyrimidin-5-yl)-(2-hydroxy-4-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 95664-45-2 | Molecular Weight | 229.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-aminopyrimidin-5-yl)-(2-hydroxy-4-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11N3O2 |
|---|---|
| Molecular Weight | 229.23500 |
| Exact Mass | 229.08500 |
| PSA | 89.83000 |
| LogP | 1.23390 |
| InChIKey | NOAIFNFKNCKGFD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2cnc(N)nc2)c(O)c1 |
|
~%
(2-aminopyrimid... CAS#:95664-45-2 |
| Literature: Thakak, K.A.; Gill, C.H. Journal of the Indian Chemical Society, 1984 , vol. 61, p. 550 - 552 |
| Methanone,(2-amino-5-pyrimidinyl)(2-hydroxy-4-methylphenyl) |