tyrosine O-sulfate structure
|
Common Name | tyrosine O-sulfate | ||
|---|---|---|---|---|
| CAS Number | 956-46-7 | Molecular Weight | 261.25200 | |
| Density | 1.6g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | L-Tyrosine O-sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Molecular Formula | C9H11NO6S |
| Molecular Weight | 261.25200 |
| Exact Mass | 261.03100 |
| PSA | 135.30000 |
| LogP | 1.60370 |
| Index of Refraction | 1.628 |
| InChIKey | CIQHWLTYGMYQQR-QMMMGPOBSA-N |
| SMILES | NC(Cc1ccc(OS(=O)(=O)O)cc1)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tyrosine O-sulfate |