2-(4-Chlorophenylthio)Nicotinic Acid
Modify Date: 2025-08-25 15:05:57
2-(4-Chlorophenylthio)Nicotinic Acid structure
|
Common Name | 2-(4-Chlorophenylthio)Nicotinic Acid | ||
|---|---|---|---|---|
| CAS Number | 955-54-4 | Molecular Weight | 265.71500 | |
| Density | 1.48g/cm3 | Boiling Point | 447.3ºC at 760mmHg | |
| Molecular Formula | C12H8ClNO2S | Melting Point | 218ºC | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | 2-(4-chlorophenyl)sulfanylpyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 447.3ºC at 760mmHg |
| Melting Point | 218ºC |
| Molecular Formula | C12H8ClNO2S |
| Molecular Weight | 265.71500 |
| Flash Point | 224.3ºC |
| Exact Mass | 264.99600 |
| PSA | 75.49000 |
| LogP | 3.58440 |
| InChIKey | FPKVNUOJWZFDNZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccnc1Sc1ccc(Cl)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933399090 |
|
~86%
2-(4-Chlorophen... CAS#:955-54-4 |
| Literature: Monge; Martinez-Merino; Cenarruzabeitia; et al. European Journal of Medicinal Chemistry, 1985 , vol. 20, # 1 p. 61 - 66 |
|
~%
2-(4-Chlorophen... CAS#:955-54-4 |
| Literature: Monge; Martinez-Merino; Cenarruzabeitia; et al. European Journal of Medicinal Chemistry, 1985 , vol. 20, # 1 p. 61 - 66 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:97936-44-2| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Chlorphenylthionicotinsaeure |
| 2-(4-chlorophenylthio)pyridine-3-carboxylic acid |
| 2-(4-chlorophenylthio)-3-pyridine carboxylic acid |
| 2-[(4-chlorophenyl)sulfanyl]pyridine-3-carboxylic acid |
| 2-[(4-chlorophenyl)thio]nicotinic acid |
| MFCD00052117 |
| 2-(p-Chlorphenylthio)-3-carboxypyridin |
| 2-(4-chloro-phenylsulfanyl)-nicotinic acid |
| 2-(2-HYDROXY-ETHYL)-6-METHYL-4H-BENZO[1,4]OXAZIN-3-ONE |