5-(2-Methyl-1H-imidazol-1-yl)-2-nitrobenzoic acid structure
|
Common Name | 5-(2-Methyl-1H-imidazol-1-yl)-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 954265-75-9 | Molecular Weight | 247.207 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 518.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C11H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.1±32.9 °C | |
| Name | 5-(2-methylimidazol-1-yl)-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 518.0±60.0 °C at 760 mmHg |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.207 |
| Flash Point | 267.1±32.9 °C |
| Exact Mass | 247.059311 |
| PSA | 100.94000 |
| LogP | 1.57 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | IUFVLPIIHJXSCC-UHFFFAOYSA-N |
| SMILES | Cc1nccn1-c1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzoic acid, 5-(2-methyl-1H-imidazol-1-yl)-2-nitro- |
| 5-(2-Methyl-1H-imidazol-1-yl)-2-nitrobenzoic acid |