Benzyl 4,7-diazaspiro[2.5]octane-7-carboxylate structure
|
Common Name | Benzyl 4,7-diazaspiro[2.5]octane-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 954240-30-3 | Molecular Weight | 246.30500 | |
| Density | 1.22g/cm3 | Boiling Point | 391.7ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.7ºC | |
| Name | Benzyl 4,7-diazaspiro[2.5]octane-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 391.7ºC at 760 mmHg |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.30500 |
| Flash Point | 190.7ºC |
| Exact Mass | 246.13700 |
| PSA | 41.57000 |
| LogP | 2.02770 |
| Index of Refraction | 1.6 |
| InChIKey | FTSCFSJJJUMAKO-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCNC2(CC2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Diazaspiro[2.5]octane-7-carboxylic acid benzyl ester |
| QC-9567 |