4,7-Diazaspiro[2.5]octane-7-carboxylic acid tert-butyl ester structure
|
Common Name | 4,7-Diazaspiro[2.5]octane-7-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 886766-28-5 | Molecular Weight | 212.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 301.3±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.0±20.9 °C | |
| Name | tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.3±17.0 °C at 760 mmHg |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.289 |
| Flash Point | 136.0±20.9 °C |
| Exact Mass | 212.152481 |
| PSA | 41.57000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | XXKCYKIJWLFVDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2(CC2)C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Diazaspiro[2.5]octane-7-carboxylic acid, 1,1-dimethylethyl ester |
| tert-Butyl-4,7-diazaspiro[2.5]octan-7-carboxylat |
| 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-7-carboxylate |
| tert-butyl 4,7-diazaspiro[2.5]octane-7-carboxylate |