Ethyl 2-oxoindoline-6-carboxylate
Modify Date: 2025-09-25 12:46:49
Ethyl 2-oxoindoline-6-carboxylate structure
|
Common Name | Ethyl 2-oxoindoline-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 954239-49-7 | Molecular Weight | 205.210 | |
| Density | 1.240 | Boiling Point | 394.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4±27.9 °C | |
| Name | ethyl 2-oxo-1,3-dihydroindole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.240 |
|---|---|
| Boiling Point | 394.5±42.0 °C at 760 mmHg |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.210 |
| Flash Point | 192.4±27.9 °C |
| Exact Mass | 205.073898 |
| PSA | 58.89000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | SDMAVFXBWFYTCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2c(c1)NC(=O)C2 |
| Hazard Codes | Xn |
|---|
|
~85%
Ethyl 2-oxoindo... CAS#:954239-49-7 |
| Literature: Roth, Gerald J.; Heckel, Armin; Colbatzky, Florian; Handschuh, Sandra; Kley, Joerg; Lehmann-Lintz, Thorsten; Lotz, Ralf; Tontsch-Grunt, Ulrike; Walter, Rainer; Hilberg, Frank Journal of Medicinal Chemistry, 2009 , vol. 52, # 14 p. 4466 - 4480 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:334952-09-9| 1H-Indole-6-carboxylic acid, 2,3-dihydro-2-oxo-, ethyl ester |
| Ethyl 2-oxo-6-indolinecarboxylate |
| ethyl 2-indolinone-6-carboxylate |
| Ethyl 2-oxoindoline-6-carboxylate |
| 2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester |
| Nintedanib Impurity 13 |