2,7-Dimethoxy-3-quinolinecarbaldehyde structure
|
Common Name | 2,7-Dimethoxy-3-quinolinecarbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 95395-23-6 | Molecular Weight | 217.221 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 373.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 179.7±26.5 °C | |
| Name | 2,7-dimethoxyquinoline-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.5±37.0 °C at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.221 |
| Flash Point | 179.7±26.5 °C |
| Exact Mass | 217.073898 |
| PSA | 48.42000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | PQECIFGEZCZGSO-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(C=O)c(OC)nc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| F2102-0013 |
| 2,7-dimethoxyquinoline-3-carbaldehyde |
| 3-Quinolinecarboxaldehyde, 2,7-dimethoxy- |
| 2,7-Dimethoxy-quinoline-3-carbaldehyde |
| 2,7-Dimethoxy-3-quinolinecarbaldehyde |
| 2,5-DIMETHYLBENZYLMAGNESIUM CHLORIDE |