2-(Trifluoromethyl)quinoline-6-carboxylic acid structure
|
Common Name | 2-(Trifluoromethyl)quinoline-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 952182-51-3 | Molecular Weight | 241.16600 | |
| Density | 1.481g/cm3 | Boiling Point | 329.5ºC at 760 mmHg | |
| Molecular Formula | C11H6F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.1ºC | |
| Name | 2-(Trifluoromethyl)quinoline-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.481g/cm3 |
|---|---|
| Boiling Point | 329.5ºC at 760 mmHg |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.16600 |
| Flash Point | 153.1ºC |
| Exact Mass | 241.03500 |
| PSA | 50.19000 |
| LogP | 2.95180 |
| Index of Refraction | 1.578 |
| InChIKey | PDWMUXHPWPBHDJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2nc(C(F)(F)F)ccc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~97%
2-(Trifluoromet... CAS#:952182-51-3 |
| Literature: PFIZER JAPAN INC.; PFIZER INC.; RENOVIS, INC. Patent: WO2008/59370 A2, 2008 ; Location in patent: Page/Page column 66 ; WO 2008/059370 A2 |
|
~%
2-(Trifluoromet... CAS#:952182-51-3 |
| Literature: US2012/88746 A1, ; Page/Page column 43 ; |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(trifluoromethyl)quinoline-6-carboxylic acid |