2,3-diamino-5-bromo-6-(trifluoromethyl)pyrimidin-4-one
Modify Date: 2025-08-30 06:35:19
2,3-diamino-5-bromo-6-(trifluoromethyl)pyrimidin-4-one structure
|
Common Name | 2,3-diamino-5-bromo-6-(trifluoromethyl)pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 95095-46-8 | Molecular Weight | 273.01100 | |
| Density | 2.32g/cm3 | Boiling Point | 264.8ºC at 760mmHg | |
| Molecular Formula | C5H4BrF3N4O | Melting Point | 226-228ºC | |
| MSDS | N/A | Flash Point | 114ºC | |
| Name | 2,3-diamino-5-bromo-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.32g/cm3 |
|---|---|
| Boiling Point | 264.8ºC at 760mmHg |
| Melting Point | 226-228ºC |
| Molecular Formula | C5H4BrF3N4O |
| Molecular Weight | 273.01100 |
| Flash Point | 114ºC |
| Exact Mass | 271.95200 |
| PSA | 86.93000 |
| LogP | 1.48300 |
| Index of Refraction | 1.641 |
| InChIKey | MQGUIHMFRJISAF-UHFFFAOYSA-N |
| SMILES | Nc1nc(C(F)(F)F)c(Br)c(=O)n1N |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933599090 |
|
~54%
2,3-diamino-5-b... CAS#:95095-46-8 |
| Literature: Hlavka; Bitha; Lin; Strohmeyer Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 5 p. 1537 - 1541 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,5,6-TETRACHLOROPHENYL ISOTHIOCYANATE |
| 2,3-diamino-5-bromo-6-(trifluoromethyl)-4(3H)-pyrimidinone |
| 5-Bromo-2,3-diamino-6-(trifluoromethyl)-4-(3H)-pyrimidone |
| HMS2634B15 |