Ethyl 7-bromo-2-methylquinoline-3-carboxylate structure
|
Common Name | Ethyl 7-bromo-2-methylquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 948290-16-2 | Molecular Weight | 294.14400 | |
| Density | 1.444g/cm3 | Boiling Point | 358.5ºC at 760 mmHg | |
| Molecular Formula | C13H12BrNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 170.6ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Ethyl 7-bromo-2-methylquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 358.5ºC at 760 mmHg |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.14400 |
| Flash Point | 170.6ºC |
| Exact Mass | 293.00500 |
| PSA | 39.19000 |
| LogP | 3.48240 |
| Index of Refraction | 1.615 |
| InChIKey | PYRVSBADHBVVGL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccc(Br)cc2nc1C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Bromo-2-methylquinoline-3-carboxylic acid ethyl ester |